Difference between revisions of "SJ06297"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc...")
(Created page with "Category:gene == Gene SJ06297 == * transcription-direction: ** positive * right-end-position: ** 361387 * left-end-position: ** 345946 * centisome-position: ** 72.19451...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] ==
+
== Gene SJ06297 ==
−
* common-name:
+
* transcription-direction:
−
** dihomo γ-linolenoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 361387
−
* inchi-key:
+
* left-end-position:
−
** fjwjalrunnzibb-ddquopdjsa-j
+
** 345946
−
* molecular-weight:
+
* centisome-position:
−
** 1051.975
+
** 72.19451   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-13435]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-16044]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN3O-328]]
−
* [[RXN-12971]]
+
** Category: [[annotation]]
−
* [[RXN-17105]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
−
{{#set: common-name=dihomo γ-linolenoyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=1051.975}}
+
== Pathway(s) associated ==
 +
* [[SPHINGOLIPID-SYN-PWY]]
 +
** '''4''' reactions found over '''11''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=361387}}
 +
{{#set: left-end-position=345946}}
 +
{{#set: centisome-position=72.19451    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ06297

  • transcription-direction:
    • positive
  • right-end-position:
    • 361387
  • left-end-position:
    • 345946
  • centisome-position:
    • 72.19451

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ06297&oldid=133077"