Difference between revisions of "SJ05317"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-609 CPD-609] == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=...")
(Created page with "Category:gene == Gene SJ05317 == * transcription-direction: ** negative * right-end-position: ** 30370 * left-end-position: ** 8805 * centisome-position: ** 9.355278 =...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-609 CPD-609] ==
+
== Gene SJ05317 ==
* common-name:
+
* transcription-direction:
** p1,p4-bis(5'-guanosyl) tetraphosphate
+
** negative
* smiles:
+
* right-end-position:
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
+
** 30370
* inchi-key:
+
* left-end-position:
** olgwxcqxrssqpo-mharetsrsa-j
+
** 8805
* molecular-weight:
+
* centisome-position:
** 864.359
+
** 9.355278   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[3.6.1.17-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[ALANINE--TRNA-LIGASE-RXN]]
{{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=864.359}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[TRNA-CHARGING-PWY]]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=30370}}
 +
{{#set: left-end-position=8805}}
 +
{{#set: centisome-position=9.355278    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ05317

  • transcription-direction:
    • negative
  • right-end-position:
    • 30370
  • left-end-position:
    • 8805
  • centisome-position:
    • 9.355278

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated