Difference between revisions of "SJ14186"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * common-name: ** l-cystathionine * smiles: ** c(scc(c([o-]...")
(Created page with "Category:gene == Gene SJ14186 == * transcription-direction: ** negative * right-end-position: ** 189209 * left-end-position: ** 177127 * centisome-position: ** 54.700565...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] ==
+
== Gene SJ14186 ==
* common-name:
+
* transcription-direction:
** l-cystathionine
+
** negative
* smiles:
+
* right-end-position:
** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
+
** 189209
* inchi-key:
+
* left-end-position:
** ilrylpwnyfxemh-whfbiakzsa-n
+
** 177127
* molecular-weight:
+
* centisome-position:
** 222.259
+
** 54.700565   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[CYSTATHIONASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
== Reaction(s) associated ==
* [[O-SUCCHOMOSERLYASE-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-14048]]
+
** Category: [[annotation]]
* [[RXN-15130]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
{{#set: transcription-direction=negative}}
* [[CYSPH-RXN]]
+
{{#set: right-end-position=189209}}
* [[CYSTATHIONASE-RXN]]
+
{{#set: left-end-position=177127}}
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
{{#set: centisome-position=54.700565    }}
* [[O-SUCCHOMOSERLYASE-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction associated=1}}
{{#set: common-name=l-cystathionine}}
 
{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}
 
{{#set: molecular-weight=222.259}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ14186

  • transcription-direction:
    • negative
  • right-end-position:
    • 189209
  • left-end-position:
    • 177127
  • centisome-position:
    • 54.700565

Organism(s) associated with this gene

Reaction(s) associated