Difference between revisions of "SJ17755"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHO-ENOL-PYRUVATE PHOSPHO-ENOL-PYRUVATE] == * common-name: ** phosphoenolpyruvate * smiles:...")
(Created page with "Category:gene == Gene SJ17755 == * transcription-direction: ** positive * right-end-position: ** 100020 * left-end-position: ** 92509 * centisome-position: ** 36.089947...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHO-ENOL-PYRUVATE PHOSPHO-ENOL-PYRUVATE] ==
+
== Gene SJ17755 ==
* common-name:
+
* transcription-direction:
** phosphoenolpyruvate
+
** positive
* smiles:
+
* right-end-position:
** c=c(op([o-])([o-])=o)c([o-])=o
+
** 100020
* inchi-key:
+
* left-end-position:
** dtbnbxwjwcwcik-uhfffaoysa-k
+
** 92509
* molecular-weight:
+
* centisome-position:
** 165.019
+
** 36.089947   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.5.1.19-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[2PGADEHYDRAT-RXN]]
+
== Reaction(s) associated ==
* [[DAHPSYN-RXN]]
+
* [[NQOR-RXN]]
* [[GTPOP]]
+
** Category: [[annotation]]
* [[PEPCARBOX-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[PEPDEPHOS-RXN]]
+
* [[RXN-12303]]
* [[PEPPIth]]
+
** Category: [[annotation]]
* [[PPC]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
+
== Pathway(s) associated ==
* [[RXN-14117]]
+
* [[PWY-7731]]
* [[RXN-14192]]
+
** '''3''' reactions found over '''1''' reactions in the full pathway
* [[RXN-14207]]
+
{{#set: transcription-direction=positive}}
== Reaction(s) known to produce the compound ==
+
{{#set: right-end-position=100020}}
* [[2.5.1.19-RXN]]
+
{{#set: left-end-position=92509}}
* [[2PGADEHYDRAT-RXN]]
+
{{#set: centisome-position=36.089947    }}
* [[DAHPSYN-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[PEPCARBOXYKIN-RXN]]
+
{{#set: nb reaction associated=2}}
* [[PEPPIth]]
+
{{#set: nb pathway associated=1}}
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=phosphoenolpyruvate}}
 
{{#set: inchi-key=inchikey=dtbnbxwjwcwcik-uhfffaoysa-k}}
 
{{#set: molecular-weight=165.019}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ17755

  • transcription-direction:
    • positive
  • right-end-position:
    • 100020
  • left-end-position:
    • 92509
  • centisome-position:
    • 36.089947

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7731
    • 3 reactions found over 1 reactions in the full pathway