Difference between revisions of "SJ19063"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * common-name: ** 2,3-diphospho-d-glycerate * s...")
(Created page with "Category:gene == Gene SJ19063 == * transcription-direction: ** positive * right-end-position: ** 162150 * left-end-position: ** 136755 * centisome-position: ** 58.97205...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] ==
+
== Gene SJ19063 ==
* common-name:
+
* transcription-direction:
** 2,3-diphospho-d-glycerate
+
** positive
* smiles:
+
* right-end-position:
** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
+
** 162150
* inchi-key:
+
* left-end-position:
** xohueycvluuejj-uwtatzphsa-i
+
** 136755
* molecular-weight:
+
* centisome-position:
** 260.998
+
** 58.97205   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-15509]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-15510]]
+
== Reaction(s) associated ==
* [[RXN-15511]]
+
* [[RXN-13729]]
* [[RXN-15512]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
+
** Category: [[orthology]]
* [[RXN-15509]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-15510]]
+
* [[RXN3DJ-11230]]
* [[RXN-15511]]
+
** Category: [[orthology]]
* [[RXN-15512]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[RXN-17276]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
* [[SGPL11]]
{{#set: common-name=2,3-diphospho-d-glycerate}}
+
** Category: [[orthology]]
{{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}}
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=260.998}}
+
* [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7119]]
 +
** '''4''' reactions found over '''16''' reactions in the full pathway
 +
* [[PWY3DJ-11470]]
 +
** '''3''' reactions found over '''10''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=162150}}
 +
{{#set: left-end-position=136755}}
 +
{{#set: centisome-position=58.97205    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ19063

  • transcription-direction:
    • positive
  • right-end-position:
    • 162150
  • left-end-position:
    • 136755
  • centisome-position:
    • 58.97205

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7119
    • 4 reactions found over 16 reactions in the full pathway
  • PWY3DJ-11470
    • 3 reactions found over 10 reactions in the full pathway