Difference between revisions of "SJ22060"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key...") |
(Created page with "Category:gene == Gene SJ22060 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-12086 ** Category:...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ22060 == |
− | * | + | == Organism(s) associated with this gene == |
− | ** | + | * [[S.japonica_carotenoid_curated]] |
− | * | + | == Reaction(s) associated == |
− | ** | + | * [[RXN-12086]] |
− | * | + | ** Category: [[orthology]] |
− | ** | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
− | * | + | * [[RXN-12579]] |
− | ** | + | ** Category: [[orthology]] |
− | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
− | * [[ | + | * [[TRIACYLGLYCEROL-LIPASE-RXN]] |
− | * [[ | + | ** Category: [[orthology]] |
− | * [[ | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
− | + | == Pathway(s) associated == | |
− | == | + | * [[PWY-6857]] |
− | * [[ | + | ** '''3''' reactions found over '''7''' reactions in the full pathway |
− | * | + | * [[LIPAS-PWY]] |
− | * [[ | + | ** '''2''' reactions found over '''3''' reactions in the full pathway |
− | + | {{#set: organism associated=S.japonica_carotenoid_curated}} | |
− | {{#set: | + | {{#set: nb reaction associated=3}} |
− | {{#set: | + | {{#set: nb pathway associated=2}} |
− | {{#set: |
Latest revision as of 11:04, 18 March 2021
Contents
Gene SJ22060
Organism(s) associated with this gene
Reaction(s) associated
- RXN-12086
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
- RXN-12579
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
- TRIACYLGLYCEROL-LIPASE-RXN
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
Pathway(s) associated
- PWY-6857
- 3 reactions found over 7 reactions in the full pathway
- LIPAS-PWY
- 2 reactions found over 3 reactions in the full pathway