Difference between revisions of "SJ11059"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: **...")
 
(Created page with "Category:gene == Gene SJ11059 == * transcription-direction: ** positive * right-end-position: ** 734801 * left-end-position: ** 724502 * centisome-position: ** 92.239784...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] ==
+
== Gene SJ11059 ==
* common-name:
+
* transcription-direction:
** β-d-fructofuranose 6-phosphate
+
** positive
* smiles:
+
* right-end-position:
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
+
** 734801
* inchi-key:
+
* left-end-position:
** bgwgxpapygqalx-arqdhwqxsa-l
+
** 724502
* molecular-weight:
+
* centisome-position:
** 258.121
+
** 92.239784   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.7.1.90-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[2TRANSKETO-RXN]]
+
== Reaction(s) associated ==
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
+
* [[RXN0-1461]]
* [[6PFRUCTPHOS-RXN]]
+
** Category: [[annotation]]
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[MANNPDEHYDROG-RXN]]
+
** Category: [[orthology]]
* [[MANNPISOM-RXN]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[PFK_]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[PGIA]]
+
== Pathway(s) associated ==
* [[PGIAh]]
+
* [[PWY0-1415]]
* [[PGIB]]
+
** '''5''' reactions found over '''n.a''' reactions in the full pathway
* [[PGIBh]]
+
* [[CHLOROPHYLL-SYN]]
* [[PGLUCISOM-RXN]]
+
** '''6''' reactions found over '''9''' reactions in the full pathway
* [[RXN-14812]]
+
* [[PWY-7159]]
* [[TRANSALDOL-RXN]]
+
** '''5''' reactions found over '''9''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[HEME-BIOSYNTHESIS-II]]
* [[2.7.1.90-RXN]]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
* [[2TRANSKETO-RXN]]
+
{{#set: transcription-direction=positive}}
* [[3.1.3.46-RXN]]
+
{{#set: right-end-position=734801}}
* [[F16BDEPHOS-RXN]]
+
{{#set: left-end-position=724502}}
* [[FRUCTOKINASE-RXN]]
+
{{#set: centisome-position=92.239784    }}
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[MANNPDEHYDROG-RXN]]
+
{{#set: nb reaction associated=1}}
* [[MANNPISOM-RXN]]
+
{{#set: nb pathway associated=4}}
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGIB]]
 
* [[PGIBh]]
 
* [[PGLUCISOM-RXN]]
 
* [[RXN-14812]]
 
* [[TRANSALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
 
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
 
{{#set: molecular-weight=258.121}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ11059

  • transcription-direction:
    • positive
  • right-end-position:
    • 734801
  • left-end-position:
    • 724502
  • centisome-position:
    • 92.239784

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY0-1415
    • 5 reactions found over n.a reactions in the full pathway
  • CHLOROPHYLL-SYN
    • 6 reactions found over 9 reactions in the full pathway
  • PWY-7159
    • 5 reactions found over 9 reactions in the full pathway
  • HEME-BIOSYNTHESIS-II
    • 4 reactions found over 4 reactions in the full pathway