Difference between revisions of "CPD-2182"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11525 == * transcription-direction: ** positive * right-end-position: ** 297608 * left-end-position: ** 287212 * centisome-position: ** 77.30333...")
(Created page with "Category:metabolite == Metabolite CPD-2182 == * common-name: ** 1-linoleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11525 ==
+
== Metabolite CPD-2182 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1-linoleoyl-2-linoleoyl-phosphatidylcholine
−
* right-end-position:
+
* smiles:
−
** 297608
+
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
−
* left-end-position:
+
* inchi-key:
−
** 287212
+
** fvxdqwzbhixiej-lndkuqbdsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 77.30333   
+
** 782.092
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8323]]
−
== Reaction(s) associated ==
+
* [[RXN-8329]]
−
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-8322]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-8328]]
−
* [[RXN-17203]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=1-linoleoyl-2-linoleoyl-phosphatidylcholine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=fvxdqwzbhixiej-lndkuqbdsa-n}}
−
* [[RXN-18301]]
+
{{#set: molecular-weight=782.092}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-18303]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7840]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=297608}}
 
−
{{#set: left-end-position=287212}}
 
−
{{#set: centisome-position=77.30333    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-2182

  • common-name:
    • 1-linoleoyl-2-linoleoyl-phosphatidylcholine
  • smiles:
    • cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • fvxdqwzbhixiej-lndkuqbdsa-n
  • molecular-weight:
    • 782.092

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-2182&oldid=136686"