Difference between revisions of "CPD-8084"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02538 == * transcription-direction: ** positive * right-end-position: ** 59266 * left-end-position: ** 45002 * centisome-position: ** 33.726036...")
(Created page with "Category:metabolite == Metabolite CPD-8084 == * common-name: ** 1-18:3-2-18:2-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02538 ==
+
== Metabolite CPD-8084 ==
* transcription-direction:
+
* common-name:
** positive
+
** 1-18:3-2-18:2-digalactosyldiacylglycerol
* right-end-position:
+
* smiles:
** 59266
+
** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
* left-end-position:
+
* inchi-key:
** 45002
+
** ohmfskzmpvonkq-ierpwchasa-n
* centisome-position:
+
* molecular-weight:
** 33.726036   
+
** 939.231
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8311]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.4.19.12-RXN]]
+
* [[RXN-8310]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=1-18:3-2-18:2-digalactosyldiacylglycerol}}
{{#set: transcription-direction=positive}}
+
{{#set: inchi-key=inchikey=ohmfskzmpvonkq-ierpwchasa-n}}
{{#set: right-end-position=59266}}
+
{{#set: molecular-weight=939.231}}
{{#set: left-end-position=45002}}
 
{{#set: centisome-position=33.726036    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-8084

  • common-name:
    • 1-18:3-2-18:2-digalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
  • inchi-key:
    • ohmfskzmpvonkq-ierpwchasa-n
  • molecular-weight:
    • 939.231

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality