Difference between revisions of "CANAVANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04557 == * transcription-direction: ** negative * right-end-position: ** 4979 * left-end-position: ** 32 * centisome-position: ** 3.03001600e-2 ==...")
(Created page with "Category:metabolite == Metabolite CANAVANINE == * common-name: ** l-canavanine * smiles: ** c(cc([n+])c(=o)[o-])onc(=[n+])n * inchi-key: ** fsbigdsbmbyopn-vkhmyheasa-o * m...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ04557 ==
+
== Metabolite CANAVANINE ==
* transcription-direction:
+
* common-name:
** negative
+
** l-canavanine
* right-end-position:
+
* smiles:
** 4979
+
** c(cc([n+])c(=o)[o-])onc(=[n+])n
* left-end-position:
+
* inchi-key:
** 32
+
** fsbigdsbmbyopn-vkhmyheasa-o
* centisome-position:
+
* molecular-weight:
** 3.03001600e-2
+
** 177.183
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-34]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.1.3.46-RXN]]
+
* [[RXN-22]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=l-canavanine}}
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: inchi-key=inchikey=fsbigdsbmbyopn-vkhmyheasa-o}}
** Category: [[annotation]]
+
{{#set: molecular-weight=177.183}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[SUGAR-PHOSPHATASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY66-423]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=4979}}
 
{{#set: left-end-position=32}}
 
{{#set: centisome-position=3.03001600e-2}}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CANAVANINE

  • common-name:
    • l-canavanine
  • smiles:
    • c(cc([n+])c(=o)[o-])onc(=[n+])n
  • inchi-key:
    • fsbigdsbmbyopn-vkhmyheasa-o
  • molecular-weight:
    • 177.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality