Difference between revisions of "OXALACETIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06007 == * transcription-direction: ** positive * right-end-position: ** 56361 * left-end-position: ** 52568 * centisome-position: ** 10.883914...")
(Created page with "Category:metabolite == Metabolite OXALACETIC_ACID == * common-name: ** oxaloacetate * smiles: ** c(c([o-])=o)c(=o)c([o-])=o * inchi-key: ** khpxuqmniqbqev-uhfffaoysa-l * m...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06007 ==
+
== Metabolite OXALACETIC_ACID ==
* transcription-direction:
+
* common-name:
** positive
+
** oxaloacetate
* right-end-position:
+
* smiles:
** 56361
+
** c(c([o-])=o)c(=o)c([o-])=o
* left-end-position:
+
* inchi-key:
** 52568
+
** khpxuqmniqbqev-uhfffaoysa-l
* centisome-position:
+
* molecular-weight:
** 10.883914   
+
** 130.057
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ASPAMINOTRANS-RXN]]
== Reaction(s) associated ==
+
* [[CITSYN-RXN]]
* [[3.1.3.16-RXN]]
+
* [[CSm]]
** Category: [[annotation]]
+
* [[MALATE-DEH-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
* [[OAAAKGtm]]
** Category: [[annotation]]
+
* [[OAACITtm]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[OXALODECARB-RXN]]
* [[RXN-17131]]
+
* [[PCr]]
** Category: [[annotation]]
+
* [[PEPCARBOXYKIN-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
* [[RXN-17132]]
+
* [[RXN-13697]]
** Category: [[annotation]]
+
* [[RXN-2464]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
* [[RXN-17133]]
+
* [[ASPAMINOTRANS-RXN]]
** Category: [[annotation]]
+
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ATPCL]]
{{#set: transcription-direction=positive}}
+
* [[MALATE-DEH-RXN]]
{{#set: right-end-position=56361}}
+
* [[OAAAKGtm]]
{{#set: left-end-position=52568}}
+
* [[OAACITtm]]
{{#set: centisome-position=10.883914    }}
+
* [[OXALOACETATE-TAUTOMERASE-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[PCr]]
{{#set: nb reaction associated=5}}
+
* [[PEPCARBOX-RXN]]
 +
* [[PPC]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN-2464]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=oxaloacetate}}
 +
{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
 +
{{#set: molecular-weight=130.057}}

Latest revision as of 11:11, 18 March 2021