Difference between revisions of "D-GLT"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21118 == * transcription-direction: ** negative * right-end-position: ** 469783 * left-end-position: ** 463339 * centisome-position: ** 76.66086...")
(Created page with "Category:metabolite == Metabolite D-GLT == * common-name: ** d-glutamate * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inchi-key: ** whuutdbjxjrkmk-gsvougtgsa-m * molecular...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ21118 ==
+
== Metabolite D-GLT ==
* transcription-direction:
+
* common-name:
** negative
+
** d-glutamate
* right-end-position:
+
* smiles:
** 469783
+
** c(ccc(c(=o)[o-])[n+])([o-])=o
* left-end-position:
+
* inchi-key:
** 463339
+
** whuutdbjxjrkmk-gsvougtgsa-m
* centisome-position:
+
* molecular-weight:
** 76.66086   
+
** 146.122
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PMPOXI-RXN]]
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=d-glutamate}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=whuutdbjxjrkmk-gsvougtgsa-m}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=146.122}}
* [[PNPOXI-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PLPSAL-PWY]]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-7204]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PYRIDOXSYN-PWY]]
 
** '''3''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7282]]
 
** '''6''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=469783}}
 
{{#set: left-end-position=463339}}
 
{{#set: centisome-position=76.66086    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite D-GLT

  • common-name:
    • d-glutamate
  • smiles:
    • c(ccc(c(=o)[o-])[n+])([o-])=o
  • inchi-key:
    • whuutdbjxjrkmk-gsvougtgsa-m
  • molecular-weight:
    • 146.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality