Difference between revisions of "CPD-13025"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20929 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
(Created page with "Category:metabolite == Metabolite CPD-13025 == * common-name: ** guanosine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) *...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13025 == |
− | + | * common-name: | |
− | + | ** guanosine 2'-monophosphate | |
− | == | + | * smiles: |
− | * | + | ** c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** wtifiazwccbcge-uuokfmhzsa-l |
− | == | + | * molecular-weight: |
− | + | ** 361.207 | |
− | + | == Reaction(s) known to consume the compound == | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12058]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=guanosine 2'-monophosphate}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=wtifiazwccbcge-uuokfmhzsa-l}} |
+ | {{#set: molecular-weight=361.207}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-13025
- common-name:
- guanosine 2'-monophosphate
- smiles:
- c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- wtifiazwccbcge-uuokfmhzsa-l
- molecular-weight:
- 361.207