Difference between revisions of "DIHYDROXY-ACETONE-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10767 == * transcription-direction: ** positive * right-end-position: ** 6775 * left-end-position: ** 5719 * centisome-position: ** 1.4867172 =...")
(Created page with "Category:metabolite == Metabolite DIHYDROXY-ACETONE-PHOSPHATE == * common-name: ** glycerone phosphate * smiles: ** c(c(=o)co)op([o-])([o-])=o * inchi-key: ** gngacratggdk...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10767 ==
+
== Metabolite DIHYDROXY-ACETONE-PHOSPHATE ==
* transcription-direction:
+
* common-name:
** positive
+
** glycerone phosphate
* right-end-position:
+
* smiles:
** 6775
+
** c(c(=o)co)op([o-])([o-])=o
* left-end-position:
+
* inchi-key:
** 5719
+
** gngacratggdkbx-uhfffaoysa-l
* centisome-position:
+
* molecular-weight:
** 1.4867172   
+
** 168.043
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[1.1.1.8-RXN]]
== Reaction(s) associated ==
+
* [[2.3.1.42-RXN]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[F16ALDOLASE-RXN]]
** Category: [[annotation]]
+
* [[FBA_]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[G3PD2]]
{{#set: transcription-direction=positive}}
+
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
{{#set: right-end-position=6775}}
+
* [[QUINOLINATE-SYNTHA-RXN]]
{{#set: left-end-position=5719}}
+
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
{{#set: centisome-position=1.4867172    }}
+
* [[RXN-15044]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[SEDOBISALDOL-RXN]]
{{#set: nb reaction associated=1}}
+
* [[TRIOSEPISOMERIZATION-RXN]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[F16ALDOLASE-RXN]]
 +
* [[FBA_]]
 +
* [[G3PD2]]
 +
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
 +
* [[GLYCERONE-KINASE-RXN]]
 +
* [[RXN-15740]]
 +
* [[RXN-15745]]
 +
* [[RXN-8631]]
 +
* [[RXN0-5260]]
 +
* [[SEDOBISALDOL-RXN]]
 +
* [[TAGAALDOL-RXN]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=glycerone phosphate}}
 +
{{#set: inchi-key=inchikey=gngacratggdkbx-uhfffaoysa-l}}
 +
{{#set: molecular-weight=168.043}}

Latest revision as of 11:12, 18 March 2021