Difference between revisions of "5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17981 == * transcription-direction: ** positive * right-end-position: ** 72750 * left-end-position: ** 48843 * centisome-position: ** 19.278332...") |
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole * smiles: ** c2([n+]=cn(c1(oc(cop(...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == |
− | * | + | * common-name: |
− | ** | + | ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole |
− | * | + | * smiles: |
− | ** | + | ** c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2) |
− | * | + | * inchi-key: |
− | ** | + | ** pdacukokvhbvhj-xvfcmesisa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 294.18 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[AIRCARBOXY-RXN]] |
− | == Reaction(s) | + | * [[PYRIMSYN1-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[AIRCARBOXY-RXN]] | |
− | + | * [[AIRS-RXN]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=5-amino-1-(5-phospho-β-d-ribosyl)imidazole}} | |
− | + | {{#set: inchi-key=inchikey=pdacukokvhbvhj-xvfcmesisa-m}} | |
− | == | + | {{#set: molecular-weight=294.18}} |
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE
- common-name:
- 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
- smiles:
- c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
- inchi-key:
- pdacukokvhbvhj-xvfcmesisa-m
- molecular-weight:
- 294.18