Difference between revisions of "ARACHIDONIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11011 == * transcription-direction: ** negative * right-end-position: ** 1263349 * left-end-position: ** 1253912 * centisome-position: ** 86.80721...") |
(Created page with "Category:metabolite == Metabolite ARACHIDONIC_ACID == * common-name: ** arachidonate * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** yzxbapsdxzzrgb-dofzraljs...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ARACHIDONIC_ACID == |
− | * | + | * common-name: |
− | ** | + | ** arachidonate |
− | * | + | * smiles: |
− | ** | + | ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] |
− | + | * inchi-key: | |
− | + | ** yzxbapsdxzzrgb-dofzraljsa-m | |
− | + | * molecular-weight: | |
− | + | ** 303.464 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[ARACHIDONATE-15-LIPOXYGENASE-RXN]] | |
− | + | * [[ARACHIDONATE-5-LIPOXYGENASE-RXN]] | |
− | + | * [[RXN-13395]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | *** | + | * [[RXN-16016]] |
− | == | + | * [[RXN6666-2]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | {{#set: common-name=arachidonate}} |
− | + | {{#set: inchi-key=inchikey=yzxbapsdxzzrgb-dofzraljsa-m}} | |
− | + | {{#set: molecular-weight=303.464}} | |
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite ARACHIDONIC_ACID
- common-name:
- arachidonate
- smiles:
- cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
- inchi-key:
- yzxbapsdxzzrgb-dofzraljsa-m
- molecular-weight:
- 303.464