Difference between revisions of "CPD-15651"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07638 == * transcription-direction: ** positive * right-end-position: ** 44912 * left-end-position: ** 43107 * centisome-position: ** 67.19824...")
(Created page with "Category:metabolite == Metabolite CPD-15651 == * common-name: ** 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ07638 ==
+
== Metabolite CPD-15651 ==
* transcription-direction:
+
* common-name:
** positive
+
** 6-trans-tridecenoyl-coa
* right-end-position:
+
* smiles:
** 44912
+
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 43107
+
** uuivzebypbpkll-hmxwsvnbsa-j
* centisome-position:
+
* molecular-weight:
** 67.19824   
+
** 957.819
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14785]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=6-trans-tridecenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=uuivzebypbpkll-hmxwsvnbsa-j}}
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
{{#set: molecular-weight=957.819}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=44912}}
 
{{#set: left-end-position=43107}}
 
{{#set: centisome-position=67.19824    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15651

  • common-name:
    • 6-trans-tridecenoyl-coa
  • smiles:
    • ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • uuivzebypbpkll-hmxwsvnbsa-j
  • molecular-weight:
    • 957.819

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality