Difference between revisions of "O-SINAPOYLCHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17437 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite O-SINAPOYLCHOLINE == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c * inchi-key: ** hu...") |
||
| (8 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite O-SINAPOYLCHOLINE == |
| − | + | * common-name: | |
| − | + | ** o-sinapoylcholine | |
| − | + | * smiles: | |
| − | * | + | ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c |
| − | + | * inchi-key: | |
| − | ** | + | ** hujxhfrxwwgyqh-uhfffaoysa-o |
| − | + | * molecular-weight: | |
| − | * | + | ** 310.369 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[2.3.1.91-RXN]] | |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=o-sinapoylcholine}} |
| − | + | {{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}} | |
| − | ** | + | {{#set: molecular-weight=310.369}} |
| − | == | ||
| − | * [[ | ||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite O-SINAPOYLCHOLINE
- common-name:
- o-sinapoylcholine
- smiles:
- c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
- inchi-key:
- hujxhfrxwwgyqh-uhfffaoysa-o
- molecular-weight:
- 310.369
