Difference between revisions of "5-HYDROXYINDOLE ACETALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22513 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 1.5.1.9-RXN ** Categor...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE == * common-name: ** 5-hydroxyindole acetaldehyde * smiles: ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) * inchi-key:...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE == |
| − | == | + | * common-name: |
| − | * | + | ** 5-hydroxyindole acetaldehyde |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) |
| − | * | + | * inchi-key: |
| − | + | ** obfapciusyhfie-uhfffaoysa-n | |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 175.187 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | {{#set: | + | * [[RXN-10780]] |
| − | {{#set: | + | * [[RXN-10781]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| + | * [[RXN-10778]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=5-hydroxyindole acetaldehyde}} | ||
| + | {{#set: inchi-key=inchikey=obfapciusyhfie-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=175.187}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE
- common-name:
- 5-hydroxyindole acetaldehyde
- smiles:
- c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o))
- inchi-key:
- obfapciusyhfie-uhfffaoysa-n
- molecular-weight:
- 175.187
