Difference between revisions of "PROTOPORPHYRINOGEN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05217 == * transcription-direction: ** positive * right-end-position: ** 60175 * left-end-position: ** 57941 * centisome-position: ** 60.82151...")
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ05217 ==
+
== Metabolite PROTOPORPHYRINOGEN ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** protoporphyrinogen ix
−
* right-end-position:
+
* smiles:
−
** 60175
+
** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
−
* left-end-position:
+
* inchi-key:
−
** 57941
+
** uhsgpdmiqqynax-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 60.82151   
+
** 566.699
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[PPPGO]]
−
== Reaction(s) associated ==
+
* [[PROTOPORGENOXI-RXN]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[3.1.3.16-RXN]]
+
* [[HEMN-RXN]]
−
** Category: [[annotation]]
+
* [[RXN0-1461]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: common-name=protoporphyrinogen ix}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=566.699}}
−
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[TRIPHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7375]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=60175}}
 
−
{{#set: left-end-position=57941}}
 
−
{{#set: centisome-position=60.82151    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite PROTOPORPHYRINOGEN

  • common-name:
    • protoporphyrinogen ix
  • smiles:
    • c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
  • inchi-key:
    • uhsgpdmiqqynax-uhfffaoysa-l
  • molecular-weight:
    • 566.699

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PROTOPORPHYRINOGEN&oldid=137847"