Difference between revisions of "CPD-10267"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00228 == * transcription-direction: ** negative * right-end-position: ** 58614 * left-end-position: ** 49709 * centisome-position: ** 8.725378...") |
(Created page with "Category:metabolite == Metabolite CPD-10267 == * common-name: ** decanoyl-coa * smiles: ** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-10267 == |
| − | * | + | * common-name: |
| − | ** | + | ** decanoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** cnkjphsefdpydb-hsjnekgzsa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 917.754 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13615]] |
| − | + | * [[RXN-14274]] | |
| − | * [[ | + | * [[RXN-9628]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[RXN-13614]] |
| − | * [[ | + | * [[RXN-14274]] |
| − | * | + | * [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]] |
| − | + | * [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=decanoyl-coa}} |
| − | + | {{#set: inchi-key=inchikey=cnkjphsefdpydb-hsjnekgzsa-j}} | |
| − | {{#set: | + | {{#set: molecular-weight=917.754}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-10267
- common-name:
- decanoyl-coa
- smiles:
- cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- cnkjphsefdpydb-hsjnekgzsa-j
- molecular-weight:
- 917.754
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- RXN-13614
- RXN-14274
- TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.
- TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.
