Difference between revisions of "CANAVANINOSUCCINATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11915 == * transcription-direction: ** positive * right-end-position: ** 425779 * left-end-position: ** 419860 * centisome-position: ** 54.293667...") |
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CANAVANINOSUCCINATE == |
− | * | + | * common-name: |
− | ** | + | ** canavaninosuccinate |
− | * | + | * smiles: |
− | ** | + | ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o |
− | + | * inchi-key: | |
− | + | ** sgymgugigtwwlu-rolxfiacsa-m | |
− | + | * molecular-weight: | |
− | + | ** 291.24 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-22]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=canavaninosuccinate}} | |
− | + | {{#set: inchi-key=inchikey=sgymgugigtwwlu-rolxfiacsa-m}} | |
− | + | {{#set: molecular-weight=291.24}} | |
− | * | ||
− | |||
− | ** | ||
− | * | ||
− | |||
− | ** | ||
− | * [[RXN- | ||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CANAVANINOSUCCINATE
- common-name:
- canavaninosuccinate
- smiles:
- c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
- inchi-key:
- sgymgugigtwwlu-rolxfiacsa-m
- molecular-weight:
- 291.24