Difference between revisions of "GLYCEROL-3P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19006 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * HYDROG-RXN ** Category...")
(Created page with "Category:metabolite == Metabolite GLYCEROL-3P == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviajx-gsvougtgsa...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ19006 ==
+
== Metabolite GLYCEROL-3P ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** sn-glycerol 3-phosphate
== Reaction(s) associated ==
+
* smiles:
* [[HYDROG-RXN]]
+
** c(op([o-])(=o)[o-])c(o)co
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** awucvroldviajx-gsvougtgsa-l
== Pathway(s) associated ==
+
* molecular-weight:
* [[PWY-6785]]
+
** 170.058
** '''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to consume the compound ==
* [[PWY-6780]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[G3PD2]]
* [[PWY-6759]]
+
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
** '''1''' reactions found over '''1''' reactions in the full pathway
+
* [[GLYCEROL-KIN-RXN]]
* [[GLUDEG-II-PWY]]
+
* [[PHOSPHAGLYPSYN-RXN]]
** '''3''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-10462]]
* [[PWY4LZ-257]]
+
* [[RXN-13112]]
** '''7''' reactions found over '''7''' reactions in the full pathway
+
* [[RXN-13805]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-1381]]
{{#set: nb reaction associated=1}}
+
* [[RXN-14965]]
{{#set: nb pathway associated=5}}
+
* [[RXN-15045]]
 +
* [[RXN-15740]]
 +
* [[RXN-15745]]
 +
* [[RXN-16024]]
 +
* [[RXN-16117]]
 +
* [[RXN-17016]]
 +
* [[RXN-17017]]
 +
* [[RXN-17018]]
 +
* [[RXN0-5260]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[1.1.1.8-RXN]]
 +
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 +
* [[G3PD2]]
 +
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[GLYCPDIESTER-RXN]]
 +
* [[RXN-13112]]
 +
* [[RXN-13805]]
 +
* [[RXN-14073]]
 +
* [[RXN-14136]]
 +
* [[RXN-14160]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=sn-glycerol 3-phosphate}}
 +
{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}
 +
{{#set: molecular-weight=170.058}}

Latest revision as of 11:14, 18 March 2021