Difference between revisions of "5-HYDROXY-TRYPTOPHAN"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22287 == * transcription-direction: ** negative * right-end-position: ** 176304 * left-end-position: ** 172145 * centisome-position: ** 96.45653...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) * inchi-key: ** l...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5-HYDROXY-TRYPTOPHAN == |
− | * | + | * common-name: |
− | ** | + | ** 5-hydroxy-l-tryptophan |
− | + | * smiles: | |
− | + | ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) | |
− | + | * inchi-key: | |
− | + | ** ldcyzajdbxycgn-vifpvbqesa-n | |
− | * | + | * molecular-weight: |
− | ** | + | ** 220.227 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN3DJ-170]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=5-hydroxy-l-tryptophan}} | |
− | + | {{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}} | |
− | + | {{#set: molecular-weight=220.227}} | |
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 5-HYDROXY-TRYPTOPHAN
- common-name:
- 5-hydroxy-l-tryptophan
- smiles:
- c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
- inchi-key:
- ldcyzajdbxycgn-vifpvbqesa-n
- molecular-weight:
- 220.227