Difference between revisions of "CPD-4211"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05908 == * transcription-direction: ** negative * right-end-position: ** 36374 * left-end-position: ** 10569 * centisome-position: ** 12.234055...")
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] * inchi-key: ** cbidrcwhncksto-...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ05908 ==
+
== Metabolite CPD-4211 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** dimethylallyl diphosphate
−
* right-end-position:
+
* smiles:
−
** 36374
+
** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 10569
+
** cbidrcwhncksto-uhfffaoysa-k
−
* centisome-position:
+
* molecular-weight:
−
** 12.234055   
+
** 243.069
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[GPPS]]
−
== Reaction(s) associated ==
+
* [[GPPSYN-RXN]]
−
* [[ATPASE-RXN]]
+
* [[IPPISOM-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-4303]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-4305]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[RXN-4307]]
−
** Category: [[annotation]]
+
* [[RXN-7810]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7811]]
−
* [[RXN-12195]]
+
* [[RXN-7813]]
−
** Category: [[annotation]]
+
* [[RXN0-6274]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-12196]]
+
* [[GPPSYN-RXN]]
−
** Category: [[annotation]]
+
* [[IDI]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[IDS2]]
−
* [[RXN0-5462]]
+
* [[IPPISOM-RXN]]
−
** Category: [[annotation]]
+
* [[RXN0-884]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) associated ==
+
{{#set: common-name=dimethylallyl diphosphate}}
−
* [[PWY-7210]]
+
{{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}}
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
{{#set: molecular-weight=243.069}}
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=36374}}
 
−
{{#set: left-end-position=10569}}
 
−
{{#set: centisome-position=12.234055    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-4211

  • common-name:
    • dimethylallyl diphosphate
  • smiles:
    • cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • cbidrcwhncksto-uhfffaoysa-k
  • molecular-weight:
    • 243.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4211&oldid=138330"