Difference between revisions of "COPROPORPHYRIN III"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDEHYDE-DEHYDROGENASE-NADP+-RXN ALDEHYDE-DEHYDROGENASE-NADP+-RXN] == * direction: ** left-to-right...")
(Created page with "Category:metabolite == Metabolite COPROPORPHYRIN_III == * common-name: ** coproporphyrin iii * smiles: ** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDEHYDE-DEHYDROGENASE-NADP+-RXN ALDEHYDE-DEHYDROGENASE-NADP+-RXN] ==
+
== Metabolite COPROPORPHYRIN_III ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** aldehyde dehydrogenase [nad(p)+]
+
** coproporphyrin iii
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.2.1.4 ec-1.2.1.4]
+
** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
== Reaction formula ==
+
* inchi-key:
* 1 [[Aldehydes]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Carboxylates]][c] '''+''' 1 [[NADPH]][c] '''+''' 2 [[PROTON]][c]
+
** jwfcywsmnrlxlx-ujjxfscmsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ06456]]
+
** 650.687
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-17518]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-17517]]
* Gene: [[SJ06470]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=coproporphyrin iii}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: inchi-key=inchikey=jwfcywsmnrlxlx-ujjxfscmsa-j}}
** Category: [[orthology]]
+
{{#set: molecular-weight=650.687}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
== Pathway(s) ==
 
* [[PWY-7269]], NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7269 PWY-7269]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11888 11888]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00634 R00634]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P11883 P11883]
 
** [http://www.uniprot.org/uniprot/Q8TBP8 Q8TBP8]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=aldehyde dehydrogenase [nad(p)+]}}
 
{{#set: ec-number=ec-1.2.1.4}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite COPROPORPHYRIN_III

  • common-name:
    • coproporphyrin iii
  • smiles:
    • cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
  • inchi-key:
    • jwfcywsmnrlxlx-ujjxfscmsa-j
  • molecular-weight:
    • 650.687

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality