|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163] == | + | == Metabolite CPD-18733 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** inositol-1,3,4,5,6-pentakisphosphate 2-kinase | + | ** 4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.1.158 ec-2.7.1.158] | + | ** cc(c)=cccc(c)=cccc(c)=ccc2(o)(c1(c=cc=cc=1[n+](=c(c)c(=o)2)[o-])) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[CPD-1107]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[MI-HEXAKISPHOSPHATE]][c] '''+''' 1 [[PROTON]][c]
| + | ** rnxnmmdmlfjckp-yefhwucqsa-n |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ21412]]
| + | ** 395.541 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]] | + | * [[RXN-17334]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-17335]] |
| − | * Gene: [[SJ22245]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: inchi-key=inchikey=rnxnmmdmlfjckp-yefhwucqsa-n}} |
| − | == Pathway(s) == | + | {{#set: molecular-weight=395.541}} |
| − | * [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-4661]], 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4661 PWY-4661]
| |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-6372]], 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372]
| |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-6369]], inositol diphosphates biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6369 PWY-6369] | |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6361]], 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6361 PWY-6361] | |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links ==
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20314 20314]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R05202 R05202]
| |
| − | {{#set: direction=left-to-right}} | |
| − | {{#set: common-name=inositol-1,3,4,5,6-pentakisphosphate 2-kinase}}
| |
| − | {{#set: ec-number=ec-2.7.1.158}}
| |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=6}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
| |
