Difference between revisions of "MALTOTETRAOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9669 RXN-9669] == * direction: ** left-to-right * common-name: ** oleoyl-lipid 12-desaturase *...")
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * smiles: ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9669 RXN-9669] ==
+
== Metabolite MALTOTETRAOSE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** oleoyl-lipid 12-desaturase
+
** maltotetraose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.22 ec-1.14.19.22]
+
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
−
== Reaction formula ==
+
* inchi-key:
−
* 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Oleoyl-lipid]][c] '''+''' 2 [[PROTON]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[Linoleoyl-groups]][c] '''+''' 2 [[WATER]][c]
+
** luewuzlmquobsb-ayqjavfrsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00667]]
+
** 666.583
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-5182]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-5995]], linoleate biosynthesis I (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5995 PWY-5995]
+
* [[GLYMALTOPHOSPHORYL-RXN]]
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-14281]]
−
== Reconstruction information  ==
+
* [[RXN-14284]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=maltotetraose}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=46333 46333]
+
{{#set: molecular-weight=666.583}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=oleoyl-lipid 12-desaturase}}
 
−
{{#set: ec-number=ec-1.14.19.22}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite MALTOTETRAOSE

  • common-name:
    • maltotetraose
  • smiles:
    • c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
  • inchi-key:
    • luewuzlmquobsb-ayqjavfrsa-n
  • molecular-weight:
    • 666.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=MALTOTETRAOSE&oldid=138620"