Difference between revisions of "SHIKIMATE-5P"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15733 RXN-15733] == * direction: ** left-to-right * common-name: ** 6-hydroxymethyl-7,8-dihydro...") |
(Created page with "Category:metabolite == Metabolite SHIKIMATE-5P == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) * inchi-key: ** qyojs...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite SHIKIMATE-5P == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** shikimate 3-phosphate |
− | * | + | * smiles: |
− | ** [ | + | ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) |
− | == | + | * inchi-key: |
− | + | ** qyojskgcwnakgw-pbxrrbtrsa-k | |
− | + | * molecular-weight: | |
− | * | + | ** 251.109 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[2.5.1.19-RXN]] |
− | ** | + | * [[SHIKIMATE-KINASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[2.5.1.19-RXN]] |
− | * [[ | + | * [[SHIKIMATE-KINASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | {{#set: common-name=shikimate 3-phosphate}} |
− | * | + | {{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}} |
− | * | + | {{#set: molecular-weight=251.109}} |
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite SHIKIMATE-5P
- common-name:
- shikimate 3-phosphate
- smiles:
- c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
- inchi-key:
- qyojskgcwnakgw-pbxrrbtrsa-k
- molecular-weight:
- 251.109