Difference between revisions of "SHIKIMATE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15733 RXN-15733] == * direction: ** left-to-right * common-name: ** 6-hydroxymethyl-7,8-dihydro...")
(Created page with "Category:metabolite == Metabolite SHIKIMATE-5P == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) * inchi-key: ** qyojs...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15733 RXN-15733] ==
+
== Metabolite SHIKIMATE-5P ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 6-hydroxymethyl-7,8-dihydropterin pyrophosphokinase
+
** shikimate 3-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.6.3 ec-2.7.6.3]
+
** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CPD-16953]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CPD-16954]][c] '''+''' 1 [[PROTON]][c]
+
** qyojskgcwnakgw-pbxrrbtrsa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ22398]]
+
** 251.109
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.5.1.19-RXN]]
−
** Category: [[orthology]]
+
* [[SHIKIMATE-KINASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[2.5.1.19-RXN]]
−
* [[PWY-6148]], tetrahydromethanopterin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6148 PWY-6148]
+
* [[SHIKIMATE-KINASE-RXN]]
−
** '''2''' reactions found over '''14''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=shikimate 3-phosphate}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=251.109}}
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=6-hydroxymethyl-7,8-dihydropterin pyrophosphokinase}}
 
−
{{#set: ec-number=ec-2.7.6.3}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite SHIKIMATE-5P

  • common-name:
    • shikimate 3-phosphate
  • smiles:
    • c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
  • inchi-key:
    • qyojskgcwnakgw-pbxrrbtrsa-k
  • molecular-weight:
    • 251.109

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SHIKIMATE-5P&oldid=138636"