Difference between revisions of "CPD-15688"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN] == * direction: ** reversi...")
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
 
(8 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN] ==
+
== Metabolite CPD-15688 ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** d-glucose 6-phosphate 1-epimerase
+
** (3z,5e)-dodeca-3,5-dienoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/5.1.3.15 ec-5.1.3.15]
+
** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[ALPHA-GLC-6-P]][c] '''<=>''' 1 [[GLC-6-P]][c]
+
** arquzfjqpywssl-nbluimthsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ08179]]
+
** 941.776
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ19646]]
+
* [[RXN-14799]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}}
* Gene: [[SJ02068]]
+
{{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}}
** Category: [[annotation]]
+
{{#set: molecular-weight=941.776}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ00085]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16252 16252]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02739 R02739]
 
{{#set: direction=reversible}}
 
{{#set: common-name=d-glucose 6-phosphate 1-epimerase}}
 
{{#set: ec-number=ec-5.1.3.15}}
 
{{#set: nb gene associated=4}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-15688

  • common-name:
    • (3z,5e)-dodeca-3,5-dienoyl-coa
  • smiles:
    • ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • arquzfjqpywssl-nbluimthsa-j
  • molecular-weight:
    • 941.776

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality