Difference between revisions of "CPD-14927"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.117-RXN 2.4.1.117-RXN] == * direction: ** left-to-right * common-name: ** udp-glucose:dolichy...")
(Created page with "Category:metabolite == Metabolite CPD-14927 == * common-name: ** phytenate * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] * inchi-key: ** wdwbnnbrpveeod-pfxvradusa-m *...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.117-RXN 2.4.1.117-RXN] ==
+
== Metabolite CPD-14927 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** udp-glucose:dolichyl-phosphate glucosyltransferase
+
** phytenate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.1.117 ec-2.4.1.117]
+
** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-12575]][c] '''+''' 1 [[DOLICHOLP]][c] '''=>''' 1 [[CPD-166]][c] '''+''' 1 [[UDP]][c]
+
** wdwbnnbrpveeod-pfxvradusa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17231]]
+
** 309.511
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN66-480]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN66-479]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=phytenate}}
−
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]], protein N-glycosylation initial phase (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]
+
{{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}}
−
** '''16''' reactions found over '''19''' reactions in the full pathway
+
{{#set: molecular-weight=309.511}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15402 15402]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01005 R01005]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P40350 P40350]
 
−
** [http://www.uniprot.org/uniprot/Q9UUT0 Q9UUT0]
 
−
** [http://www.uniprot.org/uniprot/Q9Y673 Q9Y673]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=udp-glucose:dolichyl-phosphate glucosyltransferase}}
 
−
{{#set: ec-number=ec-2.4.1.117}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14927

  • common-name:
    • phytenate
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
  • inchi-key:
    • wdwbnnbrpveeod-pfxvradusa-m
  • molecular-weight:
    • 309.511

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14927&oldid=138659"