Difference between revisions of "13-HYDROPEROXYOCTADECA-911-DIENOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRIOKINASE-RXN TRIOKINASE-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expa...")
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRIOKINASE-RXN TRIOKINASE-RXN] ==
+
== Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (13s)-hpode
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1.28 ec-2.7.1.28]
+
** cccccc(c=cc=ccccccccc(=o)[o-])oo
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[GLYCERALD]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[GAP]][c] '''+''' 1 [[PROTON]][c]
+
** jdsrhvwsamtssn-irqzeampsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ18789]]
+
** 311.44
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[LIPOXYGENASE-RXN]]
−
* [[PWY66-373]], sucrose degradation V (sucrose α-glucosidase): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-373 PWY66-373]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=(13s)-hpode}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=jdsrhvwsamtssn-irqzeampsa-m}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=311.44}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13942 13942]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01059 R01059]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-2.7.1.28}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE

  • common-name:
    • (13s)-hpode
  • smiles:
    • cccccc(c=cc=ccccccccc(=o)[o-])oo
  • inchi-key:
    • jdsrhvwsamtssn-irqzeampsa-m
  • molecular-weight:
    • 311.44

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=13-HYDROPEROXYOCTADECA-911-DIENOATE&oldid=138711"