|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-167 RXN1F-167] == | + | == Metabolite D-ALA-D-ALA == |
| − | * direction: | + | * common-name: |
| − | ** left-to-right | + | ** d-alanyl-d-alanine |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.14.11 ec-1.14.11] | + | ** cc([n+])c(=o)nc(c)c([o-])=o |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[CPD-695]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-10332]][c] '''+''' 1 [[SUC]][c]
| + | ** defjqiddeaulhb-qwwzwvqmsa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 160.172 |
| − | * Gene: [[SJ14677]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[DALADALALIG-RXN]] |
| − | * Gene: [[SJ08018]] | + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=d-alanyl-d-alanine}} |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: molecular-weight=160.172}} |
| − | * Gene: [[SJ14670]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ14675]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ14672]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ07557]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-5035]], gibberellin biosynthesis III (early C-13 hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5035 PWY-5035]
| |
| − | ** '''2''' reactions found over '''7''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R05097 R05097]
| |
| − | {{#set: direction=left-to-right}} | |
| − | {{#set: ec-number=ec-1.14.11}} | |
| − | {{#set: nb gene associated=6}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology}}
| |
| − | {{#set: reconstruction tool=pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
| |
