Difference between revisions of "CPD-15653"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5285 RXN-5285] == * direction: ** left-to-right * common-name: ** 3,8-divinyl-protochlorophylli...")
(Created page with "Category:metabolite == Metabolite CPD-15653 == * common-name: ** (3r)-hydroxy, 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5285 RXN-5285] ==
+
== Metabolite CPD-15653 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 3,8-divinyl-protochlorophyllide oxidoreductase
+
** (3r)-hydroxy, 6-cis-tridecenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.3.1.33 ec-1.3.1.33]
+
** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[DIVINYL-PROTOCHLOROPHYLLIDE-A]][c] '''+''' 1 [[Light]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[DIVINYLCHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADP]][c]
+
** adzjvtnixnsngu-ukoyhulusa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12355]]
+
** 973.818
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ09091]]
+
* [[RXN-14772]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=(3r)-hydroxy, 6-cis-tridecenoyl-coa}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=adzjvtnixnsngu-ukoyhulusa-j}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=973.818}}
== Pathway(s) ==
 
* [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN]
 
** '''6''' reactions found over '''9''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R06286 R06286]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=3,8-divinyl-protochlorophyllide oxidoreductase}}
 
{{#set: ec-number=ec-1.3.1.33}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-15653

  • common-name:
    • (3r)-hydroxy, 6-cis-tridecenoyl-coa
  • smiles:
    • ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • adzjvtnixnsngu-ukoyhulusa-j
  • molecular-weight:
    • 973.818

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality