|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYTOCHROME-C-PEROXIDASE-RXN CYTOCHROME-C-PEROXIDASE-RXN] == | + | == Metabolite CPD-12124 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** cytochrome-c peroxidase | + | ** menaquinol-6 |
| − | ** cytochrome c peroxidase
| + | * smiles: |
| − | * ec-number: | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c |
| − | ** [http://enzyme.expasy.org/EC/1.11.1.5 ec-1.11.1.5] | + | * inchi-key: |
| − | == Reaction formula == | + | ** zventdgzqvbwna-rciygobdsa-n |
| − | * 2 [[Cytochromes-C-Reduced]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 2 [[Cytochromes-C-Oxidized]][c] '''+''' 2 [[WATER]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction == | + | ** 582.908 |
| − | * Gene: [[SJ17253]] | + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[RXN-9220]] |
| − | * Gene: [[SJ16420]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=menaquinol-6}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: inchi-key=inchikey=zventdgzqvbwna-rciygobdsa-n}} |
| − | * Gene: [[SJ04585]]
| + | {{#set: molecular-weight=582.908}} |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ14435]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ01912]] | |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ08982]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links == | |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00017 R00017]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P55929 P55929]
| |
| − | ** [http://www.uniprot.org/uniprot/O66533 O66533]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9RYL1 Q9RYL1]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9KVQ2 Q9KVQ2]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZJF8 Q9ZJF8]
| |
| − | ** [http://www.uniprot.org/uniprot/O25997 O25997]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PIE3 Q9PIE3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PJ91 Q9PJ91]
| |
| − | ** [http://www.uniprot.org/uniprot/Q8X5N0 Q8X5N0]
| |
| − | ** [http://www.uniprot.org/uniprot/P14532 P14532]
| |
| − | ** [http://www.uniprot.org/uniprot/P00431 P00431]
| |
| − | ** [http://www.uniprot.org/uniprot/P37197 P37197]
| |
| − | ** [http://www.uniprot.org/uniprot/Q51658 Q51658]
| |
| − | ** [http://www.uniprot.org/uniprot/Q50233 Q50233]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=cytochrome-c peroxidase|cytochrome c peroxidase}} | |
| − | {{#set: ec-number=ec-1.11.1.5}} | |
| − | {{#set: nb gene associated=6}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
