Difference between revisions of "DIHYDROXYNAPHTHOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.2.23-RXN 3.2.2.23-RXN] == * direction: ** left-to-right * common-name: ** oxidized purine nucle...")
(Created page with "Category:metabolite == Metabolite DIHYDROXYNAPHTHOATE == * common-name: ** 2-carboxy-1,4-naphthoquinol * smiles: ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) * inchi-key:...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.2.23-RXN 3.2.2.23-RXN] ==
+
== Metabolite DIHYDROXYNAPHTHOATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** oxidized purine nucleobase lesion dna n-glycosylase
+
** 2-carboxy-1,4-naphthoquinol
−
** formamidopyrimidine dna glycosylase
+
* smiles:
−
* ec-number:
+
** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2))
−
** [http://enzyme.expasy.org/EC/3.2.2.23 ec-3.2.2.23]
+
* inchi-key:
−
== Reaction formula ==
+
** vojuxhhacrxltd-uhfffaoysa-m
−
* 1 [[DNA-containing-diamino-hydro-formamidops]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-16491]][c] '''+''' 1 [[DNA-containing-aPurinic-Sites]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 203.174
−
* Gene: [[SJ18415]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[NPHS]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ12532]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=2-carboxy-1,4-naphthoquinol}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=vojuxhhacrxltd-uhfffaoysa-m}}
−
* Gene: [[SJ12275]]
+
{{#set: molecular-weight=203.174}}
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P44948 P44948]
 
−
** [http://www.uniprot.org/uniprot/P57014 P57014]
 
−
** [http://www.uniprot.org/uniprot/P05523 P05523]
 
−
** [http://www.uniprot.org/uniprot/P19210 P19210]
 
−
** [http://www.uniprot.org/uniprot/P74290 P74290]
 
−
** [http://www.uniprot.org/uniprot/O69470 O69470]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=oxidized purine nucleobase lesion dna n-glycosylase|formamidopyrimidine dna glycosylase}}
 
−
{{#set: ec-number=ec-3.2.2.23}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite DIHYDROXYNAPHTHOATE

  • common-name:
    • 2-carboxy-1,4-naphthoquinol
  • smiles:
    • c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2))
  • inchi-key:
    • vojuxhhacrxltd-uhfffaoysa-m
  • molecular-weight:
    • 203.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DIHYDROXYNAPHTHOATE&oldid=138887"