Difference between revisions of "CPD-18319"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11592 RXN-11592] == * direction: ** left-to-right * common-name: ** 23s rrna m3ψ1915 methyl...")
(Created page with "Category:metabolite == Metabolite CPD-18319 == * common-name: ** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate * smiles: ** c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11592 RXN-11592] ==
+
== Metabolite CPD-18319 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 23s rrna m3ψ1915 methyltransferase
+
** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.177 ec-2.1.1.177]
+
** c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[23S-rRNA-pseudouridine1915]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[23S-rRNA-N3-methylpseudouridine1915]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
+
** lqrxqgmibgpnby-pzgqecojsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ14928]]
+
** 217.181
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-16991]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate}}
== External links  ==
+
{{#set: inchi-key=inchikey=lqrxqgmibgpnby-pzgqecojsa-n}}
* RHEA:
+
{{#set: molecular-weight=217.181}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=42753 42753]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=23s rrna m3ψ1915 methyltransferase}}
 
{{#set: ec-number=ec-2.1.1.177}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-18319

  • common-name:
    • n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate
  • smiles:
    • c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]
  • inchi-key:
    • lqrxqgmibgpnby-pzgqecojsa-n
  • molecular-weight:
    • 217.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality