Difference between revisions of "CPD-15668"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RETINOL-O-FATTY-ACYLTRANSFERASE-RXN RETINOL-O-FATTY-ACYLTRANSFERASE-RXN] == * direction: ** reversi...")
(Created page with "Category:metabolite == Metabolite CPD-15668 == * common-name: ** 4-cis-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RETINOL-O-FATTY-ACYLTRANSFERASE-RXN RETINOL-O-FATTY-ACYLTRANSFERASE-RXN] ==
+
== Metabolite CPD-15668 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** retinol o-fatty-acyltransferase
+
** 4-cis-undecenoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.76 ec-2.3.1.76]
+
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ACYL-COA]][c] '''+''' 1 [[CPD-13524]][c] '''<=>''' 1 [[All-trans-Retinyl-Esters]][c] '''+''' 1 [[CO-A]][c]
+
** afmmiiqkxqnedn-nsdzghcesa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ01916]]
+
** 929.765
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-14775]]
−
* Gene: [[SJ18627]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-14774]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ02128]]
+
{{#set: common-name=4-cis-undecenoyl-coa}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=afmmiiqkxqnedn-nsdzghcesa-j}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=929.765}}
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11488 11488]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02366 R02366]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=retinol o-fatty-acyltransferase}}
 
−
{{#set: ec-number=ec-2.3.1.76}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15668

  • common-name:
    • 4-cis-undecenoyl-coa
  • smiles:
    • ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • afmmiiqkxqnedn-nsdzghcesa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15668&oldid=139251"