Difference between revisions of "CPD0-1308"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8344 RXN-8344] == * direction: ** left-to-right * common-name: ** molybdopterin adenylyltransfe...")
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8344 RXN-8344] ==
+
== Metabolite CPD0-1308 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** molybdopterin adenylyltransferase
+
** glyphosate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.7.75 ec-2.7.7.75]
+
** c(ncc(=o)[o-])p(o)([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CPD-4]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-8122]][c] '''+''' 1 [[PPI]][c]
+
** xddaorkbjwwyjs-uhfffaoysa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11751]]
+
** 167.058
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-17951]]
−
* Gene: [[SJ11752]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=glyphosate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=xddaorkbjwwyjs-uhfffaoysa-l}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=167.058}}
−
== Pathway(s) ==
 
−
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31332 31332]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=molybdopterin adenylyltransferase}}
 
−
{{#set: ec-number=ec-2.7.7.75}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD0-1308

  • common-name:
    • glyphosate
  • smiles:
    • c(ncc(=o)[o-])p(o)([o-])=o
  • inchi-key:
    • xddaorkbjwwyjs-uhfffaoysa-l
  • molecular-weight:
    • 167.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD0-1308&oldid=139322"