Difference between revisions of "PWY-7822"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12658 CPD-12658] ==
+== Pathway PWY-7822 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** riboflavin cyclic-4',5'-phosphate
+** chitin degradation iii (serratia)
-* smiles:
+== Reaction(s) found ==
-** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4)))
+* [[3.2.1.14-RXN]]
-* inchi-key:
+* [[RXN-12625]]
-** cvzkydyrjqyydj-mbnywofbsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-18083 RXN-18083]
-** 437.325
+* [NoneRXN-12309 RXN-12309]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18084 RXN-18084]
-* [[RXN-11695]]
+* [NoneRXN-18079 RXN-18079]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-18080 RXN-18080]
-* [[RXN-11695]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=chitin degradation iii (serratia)}}
-{{#set: common-name=riboflavin cyclic-4',5'-phosphate}}
+{{#set: nb reaction found=2}}
-{{#set: inchi-key=inchikey=cvzkydyrjqyydj-mbnywofbsa-m}}
+{{#set: completion rate=0.29}}
-{{#set: molecular-weight=437.325}}
+{{#set: nb total reaction=7}}