Difference between revisions of "SJ20418"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * common-...")
 
(Created page with "Category:gene == Gene SJ20418 == * transcription-direction: ** positive * right-end-position: ** 344407 * left-end-position: ** 342734 * centisome-position: ** 30.17787...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] ==
+
== Gene SJ20418 ==
* common-name:
+
* transcription-direction:
** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** positive
* smiles:
+
* right-end-position:
** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
+
** 344407
* inchi-key:
+
* left-end-position:
** htjxtkbiuvfuar-xhibxcghsa-j
+
** 342734
* molecular-weight:
+
* centisome-position:
** 597.259
+
** 30.17787   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN0-302]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[2.7.1.148-RXN]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}}
+
{{#set: transcription-direction=positive}}
{{#set: molecular-weight=597.259}}
+
{{#set: right-end-position=344407}}
 +
{{#set: left-end-position=342734}}
 +
{{#set: centisome-position=30.17787    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ20418

  • transcription-direction:
    • positive
  • right-end-position:
    • 344407
  • left-end-position:
    • 342734
  • centisome-position:
    • 30.17787

Organism(s) associated with this gene

Reaction(s) associated