Difference between revisions of "GLC"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16293 RXN-16293] == * direction: ** left-to-right * common-name: ** dapdiamide c synthase * ec-...") |
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GLC == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** β-d-glucopyranose |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) |
− | == Reaction | + | * inchi-key: |
− | * | + | ** wqzgkkkjijffok-vfuothlcsa-n |
− | == | + | * molecular-weight: |
− | * | + | ** 180.157 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[ALDOSE-1-EPIMERASE-RXN]] |
− | + | * [[GLUCISOM-RXN-GLC//CPD-15382.15.]] | |
− | * | + | * [[biomass_rxn]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[3.2.1.106-RXN]] |
− | + | * [[ALDOSE-1-EPIMERASE-RXN]] | |
− | + | * [[GLUCISOM-RXN-GLC//CPD-15382.15.]] | |
− | + | * [[TREHALA-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=β-d-glucopyranose}} | |
− | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-vfuothlcsa-n}} | |
− | {{#set: common-name= | + | {{#set: molecular-weight=180.157}} |
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite GLC
- common-name:
- β-d-glucopyranose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-vfuothlcsa-n
- molecular-weight:
- 180.157