Difference between revisions of "PWY-7380"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * common-name: ** β-d-glucose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o...")
 
(Created page with "Category:pathway == Pathway PWY-7380 == * taxonomic-range: ** tax-1239 * common-name: ** biotin biosynthesis from 8-amino-7-oxononanoate ii == Reaction(s) found == * 2.8...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
+
== Pathway PWY-7380 ==
 +
* taxonomic-range:
 +
** tax-1239
 
* common-name:
 
* common-name:
** β-d-glucose 6-phosphate
+
** biotin biosynthesis from 8-amino-7-oxononanoate ii
* smiles:
+
== Reaction(s) found ==
** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o
+
* [[2.8.1.6-RXN]]
* inchi-key:
+
* [[DETHIOBIOTIN-SYN-RXN]]
** nbschqhzlsjfnq-vfuothlcsa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-14930 RXN-14930]
** 258.121
+
* [NoneRXN-17472 RXN-17472]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-17473 RXN-17473]
* [[G6PBDH]]
+
{{#set: taxonomic-range=tax-1239}}
* [[G6PBDHh]]
+
{{#set: common-name=biotin biosynthesis from 8-amino-7-oxononanoate ii}}
* [[G6PI]]
+
{{#set: nb reaction found=2}}
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
+
{{#set: completion rate=0.5}}
* [[PGIB]]
+
{{#set: nb total reaction=4}}
* [[PGIBh]]
 
* [[RXN66-579]]
 
== Reaction(s) known to produce the compound ==
 
* [[G6PI]]
 
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 
* [[PGIB]]
 
* [[PGIBh]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=β-d-glucose 6-phosphate}}
 
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-vfuothlcsa-l}}
 
{{#set: molecular-weight=258.121}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-7380

  • taxonomic-range:
    • tax-1239
  • common-name:
    • biotin biosynthesis from 8-amino-7-oxononanoate ii

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14930 RXN-14930]
  • [NoneRXN-17472 RXN-17472]
  • [NoneRXN-17473 RXN-17473]