Difference between revisions of "CPD-11647"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17884 RXN-17884] == * direction: ** left-to-right * common-name: ** s-nitrosoglutathione reduct...")
(Created page with "Category:metabolite == Metabolite CPD-11647 == * common-name: ** thermospermine * smiles: ** c([n+])ccc[n+]ccc[n+]ccc[n+] * inchi-key: ** doddbcgmrafleb-uhfffaoysa-r * mol...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17884 RXN-17884] ==
+
== Metabolite CPD-11647 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** s-nitrosoglutathione reductase
+
** thermospermine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.284 ec-1.1.1.284]
+
** c([n+])ccc[n+]ccc[n+]ccc[n+]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[S-NITROSOGLUTATHIONE]][c] '''=>''' 1 [[CPD-19217]][c] '''+''' 1 [[NAD]][c]
+
** doddbcgmrafleb-uhfffaoysa-r
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ21601]]
+
** 206.374
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-11190]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-7798]], protein S-nitrosylation and denitrosylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7798 PWY-7798]
+
* [[RXN-11190]]
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=thermospermine}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=doddbcgmrafleb-uhfffaoysa-r}}
−
== External links  ==
+
{{#set: molecular-weight=206.374}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=s-nitrosoglutathione reductase}}
 
−
{{#set: ec-number=ec-1.1.1.284}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11647

  • common-name:
    • thermospermine
  • smiles:
    • c([n+])ccc[n+]ccc[n+]ccc[n+]
  • inchi-key:
    • doddbcgmrafleb-uhfffaoysa-r
  • molecular-weight:
    • 206.374

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11647&oldid=139728"