Difference between revisions of "13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBCHLm HBCHLm] == * direction: ** reversible * common-name: ** 3-hydroxybutanoyl-coa hydro-lyase, m...") |
(Created page with "Category:metabolite == Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 == * common-name: ** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate * smiles: ** cccccc(=o)c=cc...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate |
− | + | * smiles: | |
− | + | ** cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1) | |
− | == | + | * inchi-key: |
− | + | ** vxpbdcbtmskckz-xqhnhvhjsa-m | |
− | * | + | * molecular-weight: |
− | ** | + | ** 351.462 |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[1.1.1.197-RXN]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[1.1.1.197-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=(13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate}} |
− | == | + | {{#set: inchi-key=inchikey=vxpbdcbtmskckz-xqhnhvhjsa-m}} |
− | + | {{#set: molecular-weight=351.462}} | |
− | {{#set: common-name= | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1
- common-name:
- (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
- smiles:
- cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
- inchi-key:
- vxpbdcbtmskckz-xqhnhvhjsa-m
- molecular-weight:
- 351.462