Difference between revisions of "G3P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATEDEHYDRO-RXN GLYCOLATEDEHYDRO-RXN] == * direction: ** left-to-right * common-name: ** glyco...")
(Created page with "Category:metabolite == Metabolite G3P == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] * inchi-key: ** osjppgntcrnqqc-uwtatzphsa-k...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATEDEHYDRO-RXN GLYCOLATEDEHYDRO-RXN] ==
+
== Metabolite G3P ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** glycolate dehydrogenase
+
** 3-phospho-d-glycerate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.99.14 ec-1.1.99.14]
+
** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Acceptor]][c] '''+''' 1 [[GLYCOLLATE]][c] '''=>''' 1 [[Donor-H2]][c] '''+''' 1 [[GLYOX]][c]
+
** osjppgntcrnqqc-uwtatzphsa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ21294]]
+
** 183.034
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[3PGAREARR-RXN]]
−
== Pathway(s) ==
+
* [[PGLYCDEHYDROG-RXN]]
−
* [[PWY-6649]], glycolate and glyoxylate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6649 PWY-6649]
+
* [[PHOSGLYPHOS-RXN]]
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN-15511]]
−
* [[GLYOXDEG-PWY]], glycolate and glyoxylate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY]
+
* [[RXN-15513]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-17276]]
−
* [[GLYCOLATEMET-PWY]], glycolate and glyoxylate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATEMET-PWY GLYCOLATEMET-PWY]
+
== Reaction(s) known to produce the compound ==
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
* [[3PGAREARR-RXN]]
−
== Reconstruction information  ==
+
* [[GLY3KIN-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PGLYCDEHYDROG-RXN]]
−
== External links  ==
+
* [[PHOSGLYPHOS-RXN]]
−
* RHEA:
+
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21264 21264]
+
* [[RXN-15511]]
−
* LIGAND-RXN:
+
* [[RXN-15513]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00476 R00476]
+
* [[RXN-17274]]
−
{{#set: direction=left-to-right}}
+
* [[RXN-3443]]
−
{{#set: common-name=glycolate dehydrogenase}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: ec-number=ec-1.1.99.14}}
+
{{#set: common-name=3-phospho-d-glycerate}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}
−
{{#set: nb pathway associated=3}}
+
{{#set: molecular-weight=183.034}}
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite G3P

  • common-name:
    • 3-phospho-d-glycerate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(=o)[o-]
  • inchi-key:
    • osjppgntcrnqqc-uwtatzphsa-k
  • molecular-weight:
    • 183.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=G3P&oldid=139842"