Difference between revisions of "SJ03217"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=...")
 
(Created page with "Category:gene == Gene SJ03217 == * transcription-direction: ** positive * right-end-position: ** 65655 * left-end-position: ** 19759 * centisome-position: ** 16.030863...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] ==
+
== Gene SJ03217 ==
* common-name:
+
* transcription-direction:
** sn-glycerol 3-phosphate
+
** positive
* smiles:
+
* right-end-position:
** c(op([o-])(=o)[o-])c(o)co
+
** 65655
* inchi-key:
+
* left-end-position:
** awucvroldviajx-gsvougtgsa-l
+
** 19759
* molecular-weight:
+
* centisome-position:
** 170.058
+
** 16.030863   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[G3PD2]]
+
== Reaction(s) associated ==
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[GLYCEROL-KIN-RXN]]
+
* [[PEROXID-RXN]]
* [[PHOSPHAGLYPSYN-RXN]]
+
** Category: [[annotation]]
* [[RXN-10462]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-13112]]
+
** Category: [[orthology]]
* [[RXN-13805]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-1381]]
+
* [[RXN-14240]]
* [[RXN-14965]]
+
** Category: [[annotation]]
* [[RXN-15045]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-15740]]
+
** Category: [[orthology]]
* [[RXN-15745]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-16024]]
+
* [[RXN-15288]]
* [[RXN-16117]]
+
** Category: [[annotation]]
* [[RXN-17016]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-17017]]
+
** Category: [[orthology]]
* [[RXN-17018]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN0-5260]]
+
* [[RXN-17352]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[1.1.1.8-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
** Category: [[orthology]]
* [[G3PD2]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
+
* [[RXN-8635]]
* [[GLYCEROL-KIN-RXN]]
+
** Category: [[annotation]]
* [[GLYCPDIESTER-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-13112]]
+
** Category: [[orthology]]
* [[RXN-13805]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-14073]]
+
</div>
* [[RXN-14136]]
+
== Pathway(s) associated ==
* [[RXN-14160]]
+
* [[PWY-7214]]
== Reaction(s) of unknown directionality ==
+
** '''1''' reactions found over '''2''' reactions in the full pathway
{{#set: common-name=sn-glycerol 3-phosphate}}
+
* [[PWY-7445]]
{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}
+
** '''1''' reactions found over '''4''' reactions in the full pathway
{{#set: molecular-weight=170.058}}
+
* [[PWY-5466]]
 +
** '''2''' reactions found over '''10''' reactions in the full pathway
 +
* [[PWY-6824]]
 +
** '''2''' reactions found over '''10''' reactions in the full pathway
 +
* [[PWY-5469]]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-5461]]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=65655}}
 +
{{#set: left-end-position=19759}}
 +
{{#set: centisome-position=16.030863    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=5}}
 +
{{#set: nb pathway associated=6}}

Latest revision as of 11:03, 18 March 2021

Gene SJ03217

  • transcription-direction:
    • positive
  • right-end-position:
    • 65655
  • left-end-position:
    • 19759
  • centisome-position:
    • 16.030863

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7214
    • 1 reactions found over 2 reactions in the full pathway
  • PWY-7445
    • 1 reactions found over 4 reactions in the full pathway
  • PWY-5466
    • 2 reactions found over 10 reactions in the full pathway
  • PWY-6824
    • 2 reactions found over 10 reactions in the full pathway
  • PWY-5469
    • 2 reactions found over 8 reactions in the full pathway
  • PWY-5461
    • 1 reactions found over 1 reactions in the full pathway