Difference between revisions of "PWY-7181"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUCOPELARGONIDIN-CMPD LEUCOPELARGONIDIN-CMPD] ==
+== Pathway PWY-7181 ==
+* taxonomic-range:
+** tax-33208
+** tax-2157
+** tax-2
 * common-name:
-** (2r,3s,4s)-leucopelargonidin
+** pyrimidine deoxyribonucleosides degradation
-* smiles:
+== Reaction(s) found ==
-** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
+* [[CYTIDEAM-RXN]]
-* inchi-key:
+* [[URA-PHOSPH-RXN]]
-** fsvmlwolzhgcqx-souvjxgzsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneTHYM-PHOSPH-RXN THYM-PHOSPH-RXN]
-** 290.272
+{{#set: taxonomic-range=tax-33208|tax-2|tax-2157}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=pyrimidine deoxyribonucleosides degradation}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=(2r,3s,4s)-leucopelargonidin}}
-{{#set: inchi-key=inchikey=fsvmlwolzhgcqx-souvjxgzsa-n}}
-{{#set: molecular-weight=290.272}}