Difference between revisions of "PWY-6661"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] ==
+== Pathway PWY-6661 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 2,3-dihydroxybenzoate
+** 4-hydroxy-2(1h)-quinolone biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c1(=cc=cc(=c1o)o))([o-])=o
+* [[ANTHRANSYN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** gldqamycgoijdv-uhfffaoysa-m
+* [NoneRXN-17704 RXN-17704]
-* molecular-weight:
+* [NoneRXN-17709 RXN-17709]
-** 153.114
+* [NoneRXN-17702 RXN-17702]
-== Reaction(s) known to consume the compound ==
+* [NoneAMINOBENZCOALIG-RXN AMINOBENZCOALIG-RXN]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[DHBDEHYD-RXN]]
+{{#set: common-name=4-hydroxy-2(1h)-quinolone biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=2,3-dihydroxybenzoate}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=gldqamycgoijdv-uhfffaoysa-m}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=153.114}}