Difference between revisions of "PWY66-391"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHO-COA DEPHOSPHO-COA] ==
+== Pathway PWY66-391 ==
+* taxonomic-range:
+** tax-7742
 * common-name:
-** 3'-dephospho-coa
+** fatty acid &beta;-oxidation vi (peroxisome)
-* smiles:
+== Reaction(s) found ==
-** cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))))c(o)c(=o)nccc(=o)nccs
+* [[ACYLCOASYN-RXN]]
-* inchi-key:
+* [[ENOYL-COA-HYDRAT-RXN]]
-** kdtshfargakyjn-ibosznhhsa-l
+* [[KETOACYLCOATHIOL-RXN]]
-* molecular-weight:
+* [[OHACYL-COA-DEHYDROG-RXN]]
-** 685.538
+* [[RXN-11026]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-7699]]
-* [[ADCPT]]
+== Reaction(s) not found ==
-* [[DEPHOSPHOCOAKIN-RXN]]
+* [NoneRXN66-485 RXN66-485]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-7742}}
-* [[PANTEPADENYLYLTRAN-RXN]]
+{{#set: common-name=fatty acid &beta;-oxidation vi (peroxisome)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=6}}
-{{#set: common-name=3'-dephospho-coa}}
+{{#set: completion rate=0.86}}
-{{#set: inchi-key=inchikey=kdtshfargakyjn-ibosznhhsa-l}}
+{{#set: nb total reaction=7}}
-{{#set: molecular-weight=685.538}}